| Melting point |
135-138 °C(lit.) |
| Boiling point |
303.11°C (rough estimate) |
| Density |
1.271 (estimate) |
| refractive index |
1.5060 (estimate) |
| storage temp. |
2-8°C |
| solubility |
Soluble in Water (up to 15 mg/ml) |
| pka |
9.11±0.10(Predicted) |
| form |
Powder |
| color |
White |
| optical activity |
[α]/D 220.0±5.0°, c = 1 in 0.1 M HCl |
| Water Solubility |
Miscible with water. |
| Merck |
13,9408 |
| BRN |
1865193 |
| Stability |
Stable for 2 years as supplied. Solutions in distilled water may be stored at -20°C for up to 2 months. |
| InChI |
1S/C6H12O5S/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5-,6+/m1/s1 |
| InChIKey |
KNWYARBAEIMVMZ-DVKNGEFBSA-N |
| SMILES |
OC[C@H]1S[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O |
| CAS DataBase Reference |
20408-97-3 |
| EPA Substance Registry System |
D-Glucose, 5-thio- (20408-97-3) |
