| Melting point |
201-205 °C(lit.) |
| Boiling point |
407.5±45.0 °C(Predicted) |
| Density |
1.36±0.1 g/cm3(Predicted) |
| vapor pressure |
0.012Pa at 25℃ |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Acetone (Slightly), Chloroform (Slightly), Methanol (Slightly) |
| form |
Crystalline Powder |
| color |
White to light yellow |
| InChI |
InChI=1S/C9H5NO2/c10-4-6-1-2-8-7(3-6)5-12-9(8)11/h1-3H,5H2 |
| InChIKey |
XEEGWTLAFIZLSF-UHFFFAOYSA-N |
| SMILES |
C1(=O)C2=C(C=C(C#N)C=C2)CO1 |
| LogP |
0.136 at 30℃ and pH5.03 |
| Dissociation constant |
0-0 at 30℃ |
| CAS DataBase Reference |
82104-74-3(CAS DataBase Reference) |
