| Melting point |
58-62 °C |
| Boiling point |
201.7±8.0 °C(Predicted) |
| Density |
1.030±0.06 g/cm3(Predicted) |
| FEMA |
3239 | 4-THUJANOL |
| storage temp. |
-20°C |
| solubility |
Chloroform, Ethanol (Slightly), Hexanes (Slightly) |
| pka |
15.22±0.40(Predicted) |
| color |
Off-White |
| Odor |
at 1.00 % in dipropylene glycol. minty eucalyptus green terpene |
| Odor Type |
herbal |
| optical activity |
[α]20/D +31.5±2°, c = 1% in ethanol |
| JECFA Number |
441 |
| Major Application |
cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions |
PERFUMING |
| InChI |
1S/C10H18O/c1-7(2)10-5-4-9(3,11)8(10)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9+,10+/m0/s1 |
| InChIKey |
KXSDPILWMGFJMM-IVZWLZJFSA-N |
| SMILES |
CC(C)[C@@]12CCC(C)(O)[C@@H]1C2 |
| LogP |
2.53 |
| EPA Substance Registry System |
Bicyclo[3.1.0]hexan-2-ol, 2-methyl-5-(1-methylethyl)- (546-79-2) |