546-79-2
| Name | 4-THUJANOL |
| CAS | 546-79-2 |
| EINECS(EC#) | 208-911-7 |
| Molecular Formula | C10H20O2 |
| MDL Number | MFCD00792513 |
| Molecular Weight | 172.26 |
| MOL File | 546-79-2.mol |
Chemical Properties
| Melting point | 58-62 °C |
| Boiling point | 201.7±8.0 °C(Predicted) |
| density | 1.030±0.06 g/cm3(Predicted) |
| FEMA | 3239 | 4-THUJANOL |
| storage temp. | ?20°C |
| solubility | Chloroform, Ethanol (Slightly), Hexanes (Slightly) |
| form | neat |
| pka | 15.22±0.40(Predicted) |
| color | Off-White |
| Odor | at 1.00 % in dipropylene glycol. minty eucalyptus green terpene |
| Odor Type | herbal |
| Optical Rotation | [α]20/D +31.5±2°, c = 1% in ethanol |
| JECFA Number | 441 |
| Major Application | cleaning products cosmetics flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H18O/c1-7(2)10-5-4-9(3,11)8(10)6-10/h7-8,11H,4-6H2,1-3H3/t8-,9+,10+/m0/s1 |
| InChIKey | KXSDPILWMGFJMM-IVZWLZJFSA-N |
| SMILES | CC(C)[C@@]12CCC(C)(O)[C@@H]1C2 |
| LogP | 2.53 |
