| Melting point |
146-148 °C (lit.) |
| Boiling point |
232.96°C (rough estimate) |
| Density |
1.1987 (rough estimate) |
| refractive index |
1.4209 (estimate) |
| storage temp. |
Sealed in dry,Room Temperature |
| form |
powder to lump |
| pka |
3.32±0.10(Predicted) |
| color |
White to Light yellow |
| Water Solubility |
3.984g/L(room temperature) |
| InChI |
1S/C9H8O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey |
CWJJAFQCTXFSTA-UHFFFAOYSA-N |
| SMILES |
Cc1ccc(C(O)=O)c(c1)C(O)=O |
| CAS DataBase Reference |
4316-23-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,2-Benzenedicarboxylic acid, 4-methyl-(4316-23-8) |
| EPA Substance Registry System |
1,2-Benzenedicarboxylic acid, 4-methyl- (4316-23-8) |
