4-Methylphthalic acid
- Product Name4-Methylphthalic acid
- CAS4316-23-8
- MFC9H8O4
- MW180.16
- EINECS224-333-8
- MOL File4316-23-8.mol
Chemical Properties
| Melting point | 146-148 °C (lit.) |
| Boiling point | 232.96°C (rough estimate) |
| Density | 1.1987 (rough estimate) |
| refractive index | 1.4209 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to lump |
| pka | 3.32±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | 3.984g/L(room temperature) |
| InChI | 1S/C9H8O4/c1-5-2-3-6(8(10)11)7(4-5)9(12)13/h2-4H,1H3,(H,10,11)(H,12,13) |
| InChIKey | CWJJAFQCTXFSTA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(O)=O)c(c1)C(O)=O |
| CAS DataBase Reference | 4316-23-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Benzenedicarboxylic acid, 4-methyl-(4316-23-8) |
| EPA Substance Registry System | 1,2-Benzenedicarboxylic acid, 4-methyl- (4316-23-8) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| TSCA | TSCA listed |
| HS Code | 29173995 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
