| Melting point |
281-284.5 °C(lit.) |
| Boiling point |
317.36°C (rough estimate) |
| Density |
0,56 g/cm3 |
| refractive index |
1.7010 (estimate) |
| Flash point |
325 °C |
| storage temp. |
Store below +30°C. |
| solubility |
0.1 M NaOH: 0.2 M, clear, faintly yellow |
| pka |
pK1: 1.92;pK2: 2.87;pK3: 4.49;pK4: 5.63 (25°C) |
| form |
Crystalline Powder |
| color |
White to very slightly yellow |
| Water Solubility |
1.5 g/100 mL (20 ºC) |
| Merck |
14,8004 |
| Henry's Law Constant |
1.6×1013 mol/(m3Pa) at 25℃, Yaws (2003) |
| Stability |
Stable. Incompatible with strong oxidizing agents, strong bases. |
| InChI |
1S/C10H6O8/c11-7(12)3-1-4(8(13)14)6(10(17)18)2-5(3)9(15)16/h1-2H,(H,11,12)(H,13,14)(H,15,16)(H,17,18) |
| InChIKey |
CYIDZMCFTVVTJO-UHFFFAOYSA-N |
| SMILES |
OC(=O)c1cc(C(O)=O)c(cc1C(O)=O)C(O)=O |
| LogP |
0.15 at 25℃ |
| CAS DataBase Reference |
89-05-4(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,2,4,5-Benzene-tetracarboxylic acid(89-05-4) |
| EPA Substance Registry System |
1,2,4,5-Benzenetetracarboxylic acid (89-05-4) |
