| Boiling point |
92-94 °C15 mm Hg(lit.) |
| Density |
1.752 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.5800(lit.) |
| Flash point |
188 °F |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| form |
clear liquid |
| color |
Colorless to Orange to Green |
| Sensitive |
Light Sensitive |
| BRN |
2242594 |
| InChI |
InChI=1S/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| InChIKey |
RZGYAMQMAVTAKP-UHFFFAOYSA-N |
| SMILES |
C1(C)=CC=C(F)C=C1I |
| CAS DataBase Reference |
13194-67-7(CAS DataBase Reference) |
