| Melting point |
56-59 °C(lit.) |
| Boiling point |
95-96°C 14mm |
| Density |
1.1555 (rough estimate) |
| vapor pressure |
0.856Pa at 25℃ |
| refractive index |
1.4500 (estimate) |
| Flash point |
95-96°C/14mm |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
Chloroform |
| form |
Crystalline Mass or Crystalline Powder and Chunks |
| color |
Light yellow to yellow-beige |
| Water Solubility |
Soluble in chloroform. Insoluble in water. |
| BRN |
1932887 |
| InChI |
InChI=1S/C9H7NO/c1-7(11)9-4-2-8(6-10)3-5-9/h2-5H,1H3 |
| InChIKey |
NLPHXWGWBKZSJC-UHFFFAOYSA-N |
| SMILES |
C(#N)C1=CC=C(C(C)=O)C=C1 |
| LogP |
1.531 at 25℃ |
| CAS DataBase Reference |
1443-80-7(CAS DataBase Reference) |
