4-Acetylbenzonitrile
- Product Name4-Acetylbenzonitrile
- CAS1443-80-7
- CBNumberCB6464660
- MFC9H7NO
- MW145.16
- EINECS215-885-0
- MDL NumberMFCD00001825
- MOL File1443-80-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 56-59 °C(lit.) |
| Boiling point | 95-96°C 14mm |
| Density | 1.1555 (rough estimate) |
| vapor pressure | 0.856Pa at 25℃ |
| refractive index | 1.4500 (estimate) |
| Flash point | 95-96°C/14mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform |
| form | Crystalline Mass or Crystalline Powder and Chunks |
| color | Light yellow to yellow-beige |
| Water Solubility | Soluble in chloroform. Insoluble in water. |
| BRN | 1932887 |
| InChI | InChI=1S/C9H7NO/c1-7(11)9-4-2-8(6-10)3-5-9/h2-5H,1H3 |
| InChIKey | NLPHXWGWBKZSJC-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(C(C)=O)C=C1 |
| LogP | 1.531 at 25℃ |
| CAS DataBase Reference | 1443-80-7(CAS DataBase Reference) |
| UNSPSC Code | 12352100 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312 | |||||||||
| Precautionary statements | P264-P270-P280-P301+P312-P302+P352+P312-P362+P364 | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 22-36/37/38-20/21/22 | |||||||||
| Safety Statements | 36-36/37/39-26-22 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Harmful/Irritant | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29269090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Oral | |||||||||
| NFPA 704: |
|
