| Boiling point |
89-90 °C0.5 mm Hg(lit.) |
| Density |
1.204 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.457(lit.) |
| Flash point |
192 °F |
| storage temp. |
Sealed in dry,Room Temperature |
| solubility |
Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form |
clear liquid |
| Specific Gravity |
1.204 |
| color |
Light yellow to Amber to Dark green |
| InChI |
InChI=1S/C10H9F3O/c1-7(14)5-8-3-2-4-9(6-8)10(11,12)13/h2-4,6H,5H2,1H3 |
| InChIKey |
JPHQCDCEBDRIOL-UHFFFAOYSA-N |
| SMILES |
C(C1=CC=CC(C(F)(F)F)=C1)C(=O)C |
| CAS DataBase Reference |
21906-39-8(CAS DataBase Reference) |
| NIST Chemistry Reference |
2-Propanone, 1-[3-(trifluoromethyl)phenyl]-(21906-39-8) |
