3-(Trifluoromethyl)phenylacetone
- Product Name3-(Trifluoromethyl)phenylacetone
- CAS21906-39-8
- MFC10H9F3O
- MW202.17
- EINECS244-652-6
- MOL File21906-39-8.mol
Chemical Properties
| Boiling point | 89-90 °C0.5 mm Hg(lit.) |
| Density | 1.204 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 192 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | clear liquid |
| Specific Gravity | 1.204 |
| color | Light yellow to Amber to Dark green |
| InChI | InChI=1S/C10H9F3O/c1-7(14)5-8-3-2-4-9(6-8)10(11,12)13/h2-4,6H,5H2,1H3 |
| InChIKey | JPHQCDCEBDRIOL-UHFFFAOYSA-N |
| SMILES | C(C1=CC=CC(C(F)(F)F)=C1)C(=O)C |
| CAS DataBase Reference | 21906-39-8(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Propanone, 1-[3-(trifluoromethyl)phenyl]-(21906-39-8) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-37/39 |
| WGK Germany | 3 |
| HS Code | 29147000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
