| Melting point |
172-173° |
| solubility |
Solubility in organic solvents (g/l at 20 °C) Acetone 3.1 (93.4%) Acetonitrile 4.3 Benzene 0.028 Dichloromethane 0.60 Hexane <0.001 Methanol 5.0 n‐Octanol 0.19 |
| pka |
4.9(at 25℃) |
| Water Solubility |
Solubility in water (g l1at 20 °C) 0.06 (93.4%) (pH 5) 0.61 (pH 6) Instability of the solution (pH 7) |
| Major Application |
agriculture environmental |
| InChI |
1S/C15H14F3N5O7S.Na/c1-28-9-6-10(29-2)21-13(20-9)22-14(25)23-31(26,27)11-7(12(24)30-3)4-5-8(19-11)15(16,17)18;/h4-6H,1-3H3,(H2,20,21,22,23,25);/q;+1/p-1 |
| InChIKey |
JKPSVOHVUGMYGH-UHFFFAOYSA-M |
| SMILES |
O=C([N-]S(=O)(C1=NC(C(F)(F)F)=CC=C1C(OC)=O)=O)NC2=NC(OC)=CC(OC)=N2.[Na+] |
| LogP |
0.960 |
| EPA Substance Registry System |
3-Pyridinecarboxylic acid, 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-6-(trifluoromethyl)-, methyl ester, sodium salt (1:1) (144740-54-5) |