| Melting point |
93-95 °C (lit.) |
| Boiling point |
421.9±35.0 °C(Predicted) |
| Density |
1.234±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly), Methanol (Very Slightly) |
| form |
Solid |
| pka |
pKa 1.45±0.04(7% EtOH in H2O,t =25,0.02 to 0.40M in HCl) (Uncertain) |
| color |
Light Yellow to Yellow |
| BRN |
882187 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| InChI |
InChI=1S/C14H12ClNO/c1-16-13-8-7-11(15)9-12(13)14(17)10-5-3-2-4-6-10/h2-9,16H,1H3 |
| InChIKey |
WPNMLCMTDCANOZ-UHFFFAOYSA-N |
| SMILES |
C(C1=CC(Cl)=CC=C1NC)(C1=CC=CC=C1)=O |
| CAS DataBase Reference |
1022-13-5(CAS DataBase Reference) |
| NIST Chemistry Reference |
Methanone, [5-chloro-2-(methylamino)phenyl]phenyl-(1022-13-5) |
| EPA Substance Registry System |
Methanone, [5-chloro-2-(methylamino)phenyl]phenyl- (1022-13-5) |