5-Chloro-2-(methylamino)benzophenone
- Product Name5-Chloro-2-(methylamino)benzophenone
- CAS1022-13-5
- MFC14H12ClNO
- MW245.7
- EINECS213-822-1
- MOL File1022-13-5.mol
Chemical Properties
| Melting point | 93-95 °C (lit.) |
| Boiling point | 421.9±35.0 °C(Predicted) |
| Density | 1.234±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Chloroform (Slightly), Dichloromethane (Slightly), DMSO (Slightly), Methanol (Very Slightly) |
| form | Solid |
| pka | pKa 1.45±0.04(7% EtOH in H2O,t =25,0.02 to 0.40M in HCl) (Uncertain) |
| color | Light Yellow to Yellow |
| BRN | 882187 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C14H12ClNO/c1-16-13-8-7-11(15)9-12(13)14(17)10-5-3-2-4-6-10/h2-9,16H,1H3 |
| InChIKey | WPNMLCMTDCANOZ-UHFFFAOYSA-N |
| SMILES | C(C1=CC(Cl)=CC=C1NC)(C1=CC=CC=C1)=O |
| CAS DataBase Reference | 1022-13-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Methanone, [5-chloro-2-(methylamino)phenyl]phenyl-(1022-13-5) |
| EPA Substance Registry System | Methanone, [5-chloro-2-(methylamino)phenyl]phenyl- (1022-13-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| RTECS | DJ0414000 |
| TSCA | TSCA listed |
| HS Code | 2933999552 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
