Dinotefuran
한글명:Dinotefuran
카스 번호165252-70-0
상품명:Dinotefuran
CBNumberCB9132151
분자식C7H14N4O3
포뮬러 무게202.21
MOL 파일165252-70-0.mol
화학적 성질
| 녹는점 | 94.5-101.5° |
| 끓는 점 | 334.5±34.0 °C(Predicted) |
| 밀도 | 1.42±0.1 g/cm3(Predicted) |
| 증기압 | 0Pa at 25℃ |
| 저장 조건 | Inert atmosphere,Store in freezer, under -20°C |
| 용해도 | 클로로포름(약간 용해됨), DMSO(약간 용해됨), 메탄올(약간 용해됨) |
| 산도 계수 (pKa) | 3.24±0.50(Predicted) |
| 물리적 상태 | Solid |
| 색상 | 흰색에서 옅은 갈색까지 |
| 수용성 | 39.83g/L at 20℃ |
| 안정성 | 감광성 |
| InChI | InChI=1S/C7H14N4O3/c1-8-7(10-11(12)13)9-4-6-2-3-14-5-6/h6H,2-5H2,1H3,(H2,8,9,10) |
| InChIKey | YKBZOVFACRVRJN-UHFFFAOYSA-N |
| SMILES | N([N+]([O-])=O)C(=NC)NCC1CCOC1 |
| LogP | -0.64 at 25℃ |
| EPA | Dinotefuran (165252-70-0) |
| 위험품 표기 | Xn,N | |||||||||
| 위험 카페고리 넘버 | 22-53-56-57 | |||||||||
| 안전지침서 | 61 | |||||||||
| 유엔번호(UN No.) | Controls insect pests such as aphids, whiteflies, thrips, leafhopper, leafminer, sawfly, mole cricket, white grubs, lacebugs, billbugs, beetles, mealybugs, sawfly lar- vae, and cockroaches in leafy vegetables, in residential and commercial buildings, outd | |||||||||
| WGK 독일 | 3 | |||||||||
| HS 번호 | 29329990 | |||||||||
| 유해 물질 데이터 | 165252-70-0(Hazardous Substances Data) | |||||||||
| 독성 | LD50 in male, female mice, male, female rats (mg/kg): 2450, 2275, 2804, 2000 orally; in rats (mg/kg): >2000 dermally; LC50 in carp, rainbow trout, crayfish, daphnia (ppm): >1000 (96 hr), >40 (48 hr), 5-10 (48 hr) | |||||||||
| NFPA 704: |
|
