2,2,3,3,4,4,4-Heptafluoro-1-butanol
- Product Name2,2,3,3,4,4,4-Heptafluoro-1-butanol
- CAS375-01-9
- CBNumberCB9853571
- MFC4H3F7O
- MW200.05
- EINECS206-782-1
- MDL NumberMFCD00004674
- MOL File375-01-9.mol
Chemical Properties
| Boiling point: | 96-97 °C(lit.) |
| Density | 1.6 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 77 °F |
| storage temp. | Flammables area |
| form | Crystalline Powder |
| pka | 12.53±0.10(Predicted) |
| color | White to light beige |
| Specific Gravity | 1.600 |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 1761907 |
| Henry's Law Constant | 2.1×10-2 mol/(m3Pa) at 25℃, I. et al. (1999) |
| InChI | InChI=1S/C4H3F7O/c5-2(6,1-12)3(7,8)4(9,10)11/h12H,1H2 |
| InChIKey | WXJFKAZDSQLPBX-UHFFFAOYSA-N |
| SMILES | C(O)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 375-01-9(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Butanol, 2,2,3,3,4,4,4-heptafluoro- (375-01-9) |
Safety
| Symbol(GHS) |
 GHS02 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226 | |||||||||
| Precautionary statements | P210-P370+P378 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi,F | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 16-26 | |||||||||
| RIDADR | UN 1987 3/PG 3 | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | EL4130000 | |||||||||
| Hazard Note | Flammable/Irritant | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2905590090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications | Flam. Liq. 3 | |||||||||
| REACH Registrations | Inactive | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|