Diisopropylcarbamoyl chloride
- Product NameDiisopropylcarbamoyl chloride
- CAS19009-39-3
- CBNumberCB9775431
- MFC7H14ClNO
- MW163.65
- EINECS242-743-5
- MDL NumberMFCD00015013
- MOL File19009-39-3.mol
Chemical Properties
| Melting point: | 57-59 °C (lit.) |
| Boiling point: | 90-93 °C/15 mmHg (lit.) |
| Density | 1.019 |
| refractive index | 1.5580 (estimate) |
| Flash point: | 82℃ |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| form | Crystalline Powder or To Low Melting Solid |
| pka | -1.97±0.70(Predicted) |
| color | Colorless to pale yellow or white to pale yellow |
| BRN | 1754834 |
| InChI | InChI=1S/C7H14ClNO/c1-5(2)9(6(3)4)7(8)10/h5-6H,1-4H3 |
| InChIKey | RSAFAYLZKCYUQW-UHFFFAOYSA-N |
| SMILES | C(Cl)(=O)N(C(C)C)C(C)C |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 10-21 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2924199090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|