Trimethylacetic anhydride
- Product NameTrimethylacetic anhydride
- CAS1538-75-6
- CBNumberCB9470666
- MFC10H18O3
- MW186.25
- EINECS216-263-1
- MDL NumberMFCD00008842
- MOL File1538-75-6.mol
Chemical Properties
| Boiling point: | 193 °C(lit.) |
| Density | 0.918 g/mL at 25 °C(lit.) |
| vapor pressure | 62.1Pa at 25℃ |
| refractive index | n |
| Flash point: | 135 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Miscible with acetonitrile. |
| form | Liquid |
| color | Clear colorless |
| Sensitive | Moisture Sensitive |
| BRN | 386552 |
| InChI | InChI=1S/C10H18O3/c1-9(2,3)7(11)13-8(12)10(4,5)6/h1-6H3 |
| InChIKey | PGZVFRAEAAXREB-UHFFFAOYSA-N |
| SMILES | C(C)(C)(C)C(=O)OC(=O)C(C)(C)C |
| LogP | 2.15 |
| CAS DataBase Reference | 1538-75-6(CAS DataBase Reference) |
| EPA Substance Registry System | Propanoic acid, 2,2-dimethyl-, anhydride (1538-75-6) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H314 | |||||||||
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 2920 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 9-13-21 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2915900090 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 STOT SE 3 |
|||||||||
| REACH Registrations | Inactive | |||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
