Bis(3,5-dimethylphenyl)chlorophosphine
- Product NameBis(3,5-dimethylphenyl)chlorophosphine
- CAS74289-57-9
- CBNumberCB9301537
- MFC16H18ClP
- MW276.74
- EINECS636-136-8
- MDL NumberMFCD01630841
- MOL File74289-57-9.mol
Chemical Properties
| Boiling point: | 115-135 °C(Press: 0.015 Torr) |
| Density | 1.102 g/mL at 25 °C |
| refractive index | n20/D 1.606 |
| Flash point: | 110 °C |
| storage temp. | 2-8°C, protect from light, stored under nitrogen |
| form | liquid |
| Appearance | Colorless to light yellow Liquid |
| Water Solubility | Reacts with water. |
| Sensitive | Moisture Sensitive |
| InChI | 1S/C16H18ClP/c1-11-5-12(2)8-15(7-11)18(17)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
| InChIKey | FCEBDAANWYNQMO-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(c1)P(Cl)c2cc(C)cc(C)c2 |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-43-45 | |||||||||
| RIDADR | UN3261 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2931900090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| NFPA 704: |
|