1-BROMO-2-BUTANONE
- Product Name1-BROMO-2-BUTANONE
- CAS816-40-0
- CBNumberCB9262467
- MFC4H7BrO
- MW151
- EINECS212-431-3
- MDL NumberMFCD00000207
- MOL File816-40-0.mol
Chemical Properties
| Boiling point: | 105 °C150 mm Hg(lit.) |
| Density | 1.479 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 155 °F |
| storage temp. | Keep Cold |
| form | Liquid |
| Specific Gravity | 1.479 |
| color | Colorless to light yellow |
| Sensitive | Lachrymatory |
| BRN | 741894 |
| InChI | InChI=1S/C4H7BrO/c1-2-4(6)3-5/h2-3H2,1H3 |
| InChIKey | CCXQVBSQUQCEEO-UHFFFAOYSA-N |
| SMILES | C(Br)C(=O)CC |
| CAS DataBase Reference | 816-40-0(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302+H312+H332-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P280-P301+P312-P302+P352+P312-P304+P340+P312-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn,Xi,F | |||||||||
| Risk Statements | 20/21/22-36/37/38 | |||||||||
| Safety Statements | 26-27-36/37/39 | |||||||||
| RIDADR | 1693 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | EL7000000 | |||||||||
| Hazard Note | Harmful/Irritant/Lachrymatory | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29147000 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|