3,5-Bis(trifluoromethyl)benzyl bromide
- Product Name3,5-Bis(trifluoromethyl)benzyl bromide
- CAS32247-96-4
- CBNumberCB8709789
- MFC9H5BrF6
- MW307.03
- EINECS250-971-1
- MDL NumberMFCD00009905
- MOL File32247-96-4.mol
Chemical Properties
| Melting point: | 18 °C |
| Boiling point: | 140 °C/14 mmHg |
| Density | 1.67 |
| refractive index | 1.44 |
| Flash point: | 26 °C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Difficult to mix. |
| form | powder to lump to clear liquid |
| color | White or Colorles to Yellow to Orange |
| Specific Gravity | 1.675 |
| Sensitive | Lachrymatory |
| BRN | 656506 |
| InChI | InChI=1S/C9H5BrF6/c10-4-5-1-6(8(11,12)13)3-7(2-5)9(14,15)16/h1-3H,4H2 |
| InChIKey | ATLQGZVLWOURFU-UHFFFAOYSA-N |
| SMILES | C1(CBr)=CC(C(F)(F)F)=CC(C(F)(F)F)=C1 |
| CAS DataBase Reference | 32247-96-4(CAS DataBase Reference) |
| NIST Chemistry Reference | 3,5-Bis(trifluoromethyl)benzyl bromide(32247-96-4) |
Safety
| Symbol(GHS) |
  GHS02,GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H314 | |||||||||
| Precautionary statements | P210-P233-P240-P280-P303+P361+P353-P305+P351+P338 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C,F | |||||||||
| Risk Statements | 10-34 | |||||||||
| Safety Statements | 26-36/37/39-45-25-16 | |||||||||
| RIDADR | UN 2920 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive/Lachrymatory | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2903999090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Dam. 1 Flam. Liq. 3 Skin Corr. 1B |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|
