(1S)-(1)-beta-Pinene
- Product Name(1S)-(1)-beta-Pinene
- CAS18172-67-3
- CBNumberCB8270232
- MFC10H16
- MW136.23
- EINECS242-060-2
- MDL NumberMFCD00001345
- MOL File18172-67-3.mol
Chemical Properties
| Melting point: | −61 °C(lit.) |
| alpha | -18.5 º (c=neat 25 ºC) |
| Boiling point: | 165-167 °C(lit.) |
| Density | 0.866 g/mL at 25 °C |
| vapor density | 4.7 (vs air) |
| vapor pressure | ~2 mm Hg ( 20 °C) |
| FEMA | 2903 | BETA-PINENE |
| refractive index | n |
| Flash point: | 91 °F |
| storage temp. | 2-8°C |
| solubility | 95% ethanol: soluble1ml/3ml, clear, colorless |
| form | Liquid |
| color | Clear colorless to pale yellow |
| Odor | at 10.00 % in dipropylene glycol. dry woody fresh pine hay green resinous |
| Odor Type | herbal |
| biological source | synthetic |
| optical activity | [α]25/D 22°, neat |
| Odor Threshold | 0.033ppm |
| Water Solubility | insoluble |
| Merck | 14,7446 |
| BRN | 2038282 |
| Cosmetics Ingredients Functions | PERFUMING |
| InChI | 1S/C10H16/c1-7-4-5-8-6-9(7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9-/m0/s1 |
| InChIKey | WTARULDDTDQWMU-IUCAKERBSA-N |
| SMILES | [H][C@]12CCC(=C)[C@]([H])(C1)C2(C)C |
| LogP | 4.4 at 25℃ |
| CAS DataBase Reference | 18172-67-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Bicyclo[3.1.1]heptane, 6,6-dimethyl-2-methylene-, (1S)-(18172-67-3) |
| EPA Substance Registry System | (-)-.beta.-Pinene (18172-67-3) |
Safety
| Symbol(GHS) |
    GHS02,GHS07,GHS08,GHS09 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H226-H304-H315-H317-H410 | |||||||||
| Precautionary statements | P210-P273-P280-P301+P310-P303+P361+P353-P331 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xn,N,Xi | |||||||||
| Risk Statements | 10-20/21/22-36/37/38-43-51-65-51/53-50 | |||||||||
| Safety Statements | 16-26-36/37-46-61-62 | |||||||||
| RIDADR | UN 2319 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DT5077000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29021910 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 1 Asp. Tox. 1 Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 |
|||||||||
| REACH Registrations | Active | |||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|