2-Ethylhexyl salicylate
- Product Name2-Ethylhexyl salicylate
- CAS118-60-5
- CBNumberCB7763016
- MFC15H22O3
- MW250.33
- EINECS204-263-4
- MDL NumberMFCD00053300
- MOL File118-60-5.mol
Chemical Properties
| Boiling point: | 189-190 °C/21 mmHg (lit.) |
| Density | 1.014 g/mL at 25 °C (lit.) |
| vapor pressure | 0.018Pa at 20℃ |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| pka | 8.13±0.30(Predicted) |
| form | Liquid |
| color | A colourless liquid. |
| Odor | at 100.00 %. mild orchid sweet balsam |
| Odor Type | floral |
| biological source | synthetic |
| Water Solubility | 74.4μg/L at 20℃ |
| Merck | 14,6770 |
| BRN | 2730664 |
| Major Application | cleaning products cosmetics environmental flavors and fragrances food and beverages personal care |
| Cosmetics Ingredients Functions | LIGHT STABILIZER UV ABSORBER UV FILTER |
| Cosmetic Ingredient Review (CIR) | 2-Ethylhexyl salicylate (118-60-5) |
| InChI | 1S/C15H22O3/c1-3-5-8-12(4-2)11-18-15(17)13-9-6-7-10-14(13)16/h6-7,9-10,12,16H,3-5,8,11H2,1-2H3 |
| InChIKey | FMRHJJZUHUTGKE-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)c1ccccc1O |
| LogP | 5.94 at 25℃ |
| CAS DataBase Reference | 118-60-5(CAS DataBase Reference) |
| NIST Chemistry Reference | Salicylic acid, 2-ethylhexyl ester(118-60-5) |
| EPA Substance Registry System | 2-Ethylhexyl salicylate (118-60-5) |
Safety
| Symbol(GHS) |
 GHS09 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H410 | |||||||||
| Precautionary statements | P273-P391-P501 | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| WGK Germany | - | |||||||||
| RTECS | VO3150000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2918230000 | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications | Aquatic Chronic 1 | |||||||||
| Toxicity | LD50 intraperitoneal in mouse: 200mg/kg | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|