BOC-L-3,4-Difluorophe
- Product NameBOC-L-3,4-Difluorophe
- CAS198474-90-7
- CBNumberCB7354599
- MFC14H17F2NO4
- MW301.29
- MDL NumberMFCD00672518
- MOL File198474-90-7.mol
Chemical Properties
| Melting point: | 95-105°C |
| Boiling point: | 430.4±45.0 °C(Predicted) |
| Density | 1.270±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,2-8°C |
| solubility | slightly sol. in Methanol |
| form | powder to crystal |
| pka | 3.79±0.10(Predicted) |
| color | White to Light yellow |
| optical activity | 5.3° (C=0.01 g/ml, MEOH) |
| BRN | 8566144 |
| Major Application | peptide synthesis |
| InChI | 1S/C14H17F2NO4/c1-14(2,3)21-13(20)17-11(12(18)19)7-8-4-5-9(15)10(16)6-8/h4-6,11H,7H2,1-3H3,(H,17,20)(H,18,19)/t11-/m0/s1 |
| InChIKey | CYAOPVHXASZUDE-NSHDSACASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](Cc1ccc(F)c(F)c1)C(O)=O |
| CAS DataBase Reference | 198474-90-7(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H302-H315-H319-H335 | |||||||||
| Precautionary statements | P261-P301+P312-P302+P352-P304+P340-P305+P351+P338 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | Xi | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Irritant | |||||||||
| HS Code | 2924297099 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| NFPA 704: |
|