1-Adamantanethiol
- Product Name1-Adamantanethiol
- CAS34301-54-7
- CBNumberCB7308673
- MFC10H16S
- MW168.3
- MDL NumberMFCD00213530
- MOL File34301-54-7.mol
Chemical Properties
| Melting point: | 99-106 °C |
| Boiling point: | 237.8±9.0℃ (760 Torr) |
| Density | 1.09±0.1 g/cm3 (20 ºC 760 Torr) |
| Flash point: | 94.2±16.7℃ |
| storage temp. | Storage temp. 2-8°C |
| form | solid |
| pka | 11.05±0.20(Predicted) |
| Appearance | White to off-white Solid |
| Sensitive | Hygroscopic |
| InChI | InChI=1S/C10H16S/c11-10-4-7-1-8(5-10)3-9(2-7)6-10/h7-9,11H,1-6H2 |
| InChIKey | ADJJLNODXLXTIH-UHFFFAOYSA-N |
| SMILES | C12(S)CC3CC(CC(C3)C1)C2 |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301-H319 | |||||||||
| Precautionary statements | P301+P310+P330-P305+P351+P338 | |||||||||
| Hazard Codes | T,N | |||||||||
| Risk Statements | 25-36-51/53 | |||||||||
| Safety Statements | 26-36/37-45-60-61 | |||||||||
| RIDADR | UN 2811 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| HazardClass | 6.1 | |||||||||
| HS Code | 2930909099 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Oral Eye Irrit. 2 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|