Pentafluorobenzenesulfonyl chloride
- Product NamePentafluorobenzenesulfonyl chloride
- CAS832-53-1
- CBNumberCB7243712
- MFC6ClF5O2S
- MW266.57
- EINECS212-620-0
- MDL NumberMFCD00007427
- MOL File832-53-1.mol
Chemical Properties
| Boiling point: | 210-211 °C(lit.) |
| Density | 1.796 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 195 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.797 |
| Water Solubility | Soluble in water (reacts slowly). |
| Sensitive | Moisture Sensitive |
| BRN | 2142325 |
| InChI | InChI=1S/C6ClF5O2S/c7-15(13,14)6-4(11)2(9)1(8)3(10)5(6)12 |
| InChIKey | UOJCTEGNHXRPKO-UHFFFAOYSA-N |
| SMILES | C1(S(Cl)(=O)=O)=C(F)C(F)=C(F)C(F)=C1F |
| CAS DataBase Reference | 832-53-1(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 26-36/37/39-45-24/25 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 21 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29049090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1.0 L (0.3 gallons) (liquid) or 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|