2,4-Difluorobenzenesulfonyl chloride
- Product Name2,4-Difluorobenzenesulfonyl chloride
- CAS13918-92-8
- CBNumberCB5113972
- MFC6H3ClF2O2S
- MW212.6
- EINECS629-141-1
- MDL NumberMFCD00042481
- MOL File13918-92-8.mol
Chemical Properties
| Boiling point: | 101-102 °C (1 mmHg) |
| Density | 1.581 g/mL at 25 °C(lit.) |
| refractive index | 1.5187 |
| Flash point: | >110°C |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| form | Liquid |
| color | Clear colorless to light yellow |
| Sensitive | Moisture Sensitive |
| BRN | 2970373 |
| InChI | 1S/C6H3ClF2O2S/c7-12(10,11)6-2-1-4(8)3-5(6)9/h1-3H |
| InChIKey | FJSAJUXIHJIAMD-UHFFFAOYSA-N |
| SMILES | Fc1ccc(c(F)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 13918-92-8(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363-P405 | |||||||||
| PPE | Faceshields, Gloves, Goggles, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 45-36/37/39-26 | |||||||||
| RIDADR | 3265 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2904990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|