Triisopropoxyvanadium(V) oxide
- Product NameTriisopropoxyvanadium(V) oxide
- CAS5588-84-1
- CBNumberCB7147685
- MFC9H21O4V
- MW244.2
- EINECS226-997-4
- MDL NumberMFCD00015017
- MOL File5588-84-1.mol
Chemical Properties
| Melting point: | −14 to −11 °C (7 to 12 °F; 259 to 262 K) |
| Boiling point: | 242 °C (468 °F; 515 K) |
| Density | 1.04 |
| refractive index | 1.48 |
| Flash point: | 70 °C |
| storage temp. | Flammables area |
| solubility | Miscible with toluene, hexane and isopropanol. |
| form | clear liquid |
| color | Light yellow to Brown |
| Specific Gravity | 1.035 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| InChI | 1S/3C3H7O.O.V/c3*1-3(2)4;;/h3*3H,1-2H3;;/q3*-1;;+3 |
| InChIKey | DSGGJXAUQHKOGQ-UHFFFAOYSA-N |
| SMILES | CC(C)O[V](=O)(OC(C)C)OC(C)C |
| CAS DataBase Reference | 5588-84-1(CAS DataBase Reference) |
| EPA Substance Registry System | Vanadium, oxotris(2-propanolato)-, (T-4)- (5588-84-1) |
Safety
| Symbol(GHS) |
  GHS02,GHS07 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H226-H315-H319-H335 | |||||||||
| Precautionary statements | P210-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | Xi | |||||||||
| Risk Statements | 10-36/37/38 | |||||||||
| Safety Statements | 16-26-27 | |||||||||
| RIDADR | UN 1993 3/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 3 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2909199090 | |||||||||
| Storage Class | 3 - Flammable liquids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
|||||||||
| NFPA 704: |
|