
5588-84-1
| Name | TRIISOPROPOXYVANADIUM(V) OXIDE |
| CAS | 5588-84-1 |
| EINECS(EC#) | 226-997-4 |
| Molecular Formula | C9H21O4V |
| MDL Number | MFCD00015017 |
| Molecular Weight | 244.2 |
| MOL File | 5588-84-1.mol |
Chemical Properties
| Melting point | -11°C |
| Boiling point | 80-82 °C2 mm Hg(lit.) |
| density | 1.035 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | 113 °F |
| storage temp. | Flammables area |
| solubility | Miscible with toluene, hexane and isopropanol. |
| form | Liquid |
| color | Pale yellow-orange |
| Specific Gravity | 1.035 |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| Sensitive | Moisture Sensitive |
| Exposure limits | NIOSH: Ceiling 0.05 mg/m3 |
| InChI | 1S/3C3H7O.O.V/c3*1-3(2)4;;/h3*3H,1-2H3;;/q3*-1;;+3 |
| InChIKey | DSGGJXAUQHKOGQ-UHFFFAOYSA-N |
| SMILES | CC(C)O[V](=O)(OC(C)C)OC(C)C |
| CAS DataBase Reference | 5588-84-1(CAS DataBase Reference) |
| EPA Substance Registry System | Vanadium, oxotris(2-propanolato)-, (T-4)- (5588-84-1) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| TSCA | Yes |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29055900 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |

