4-(Chloromethyl)tolunitrile
- Product Name4-(Chloromethyl)tolunitrile
- CAS874-86-2
- CBNumberCB6733863
- MFC8H6ClN
- MW151.59
- EINECS212-869-5
- MDL NumberMFCD00019761
- MOL File874-86-2.mol
Chemical Properties
| Melting point: | 77 °C |
| Boiling point: | 263 °C |
| Density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Off-white to pale yellow |
| BRN | 742357 |
| InChI | InChI=1S/C8H6ClN/c9-5-7-1-3-8(6-10)4-2-7/h1-4H,5H2 |
| InChIKey | LOQLDQJTSMKBJU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(CCl)C=C1 |
| CAS DataBase Reference | 874-86-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(CH2Cl)-C6H4-CN(874-86-2) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H314 | |||||||||
| Precautionary statements | P260-P280-P301+P312+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 | |||||||||
| Hazard Codes | T,C | |||||||||
| Risk Statements | 20/21-65-36/37/38-32-23/25-34-22 | |||||||||
| Safety Statements | 23-36-45-36/37/39-26-24/25 | |||||||||
| RIDADR | 3276 | |||||||||
| WGK Germany | 2 | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2926909090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |
|||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|
