
874-86-2
| Name | 4-(Chloromethyl)tolunitrile |
| CAS | 874-86-2 |
| EINECS(EC#) | 212-869-5 |
| Molecular Formula | C8H6ClN |
| MDL Number | MFCD00019761 |
| Molecular Weight | 151.59 |
| MOL File | 874-86-2.mol |
Chemical Properties
| Appearance | White to light yellow crystal powde |
| Melting point | 77 °C |
| Boiling point | 263 °C |
| density | 1.18±0.1 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | soluble in Methanol |
| form | Crystalline Powder |
| color | Off-white to pale yellow |
| BRN | 742357 |
| InChI | InChI=1S/C8H6ClN/c9-5-7-1-3-8(6-10)4-2-7/h1-4H,5H2 |
| InChIKey | LOQLDQJTSMKBJU-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(CCl)C=C1 |
| CAS DataBase Reference | 874-86-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 4-(CH2Cl)-C6H4-CN(874-86-2) |
Safety Data
| Symbol(GHS) | ![]() ![]() GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H314 |
| Precautionary statements | P260-P280-P301+P312+P330-P301+P330+P331-P303+P361+P353-P305+P351+P338 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | 3276 |
| WGK Germany | 2 |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29269090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 Skin Corr. 1B |

