Hexafluoroglutaric acid
- Product NameHexafluoroglutaric acid
- CAS376-73-8
- CBNumberCB6704740
- MFC5H2F6O4
- MW240.06
- EINECS206-813-9
- MDL NumberMFCD00004172
- MOL File376-73-8.mol
Chemical Properties
| Melting point: | 88-91 °C (lit.) |
| Boiling point: | 134-138 °C/3 mmHg (lit.) |
| Density | 1.6649 (estimate) |
| Flash point: | 134-138°C/3mm |
| storage temp. | Storage temp. 2-8°C |
| pka | 0.23±0.10(Predicted) |
| form | powder to crystal |
| color | White to Brown to Dark purple |
| Sensitive | Hygroscopic |
| BRN | 1801049 |
| Stability: | hygroscopic |
| InChI | 1S/C5H2F6O4/c6-3(7,1(12)13)5(10,11)4(8,9)2(14)15/h(H,12,13)(H,14,15) |
| InChIKey | CCUWGJDGLACFQT-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(O)=O |
| CAS DataBase Reference | 376-73-8(CAS DataBase Reference) |
| EPA Substance Registry System | Pentanedioic acid, hexafluoro- (376-73-8) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H318 | |||||||||
| Precautionary statements | P260h-P301+P330+P331-P303+P361+P353-P405-P501a-P280-P305+P351+P338-P310 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C,Xi | |||||||||
| Risk Statements | 34-37 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| F | 3 | |||||||||
| Hazard Note | Corrosive/Hygroscopic | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | IRRITANT, HYGROSCOPIC, CORROSIVE | |||||||||
| HazardClass | 8 | |||||||||
| HS Code | 2917190090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B |
|||||||||
| NFPA 704: |
|