1,2,7,8-Diepoxyoctane
- Product Name1,2,7,8-Diepoxyoctane
- CAS2426-07-5
- CBNumberCB6689366
- MFC8H14O2
- MW142.2
- EINECS219-375-9
- MDL NumberMFCD00005155
- MOL File2426-07-5.mol
Chemical Properties
| Melting point: | 7 °C |
| Boiling point: | 101 °C/7 mmHg |
| Density | 0.99 |
| vapor pressure | <1 hPa ( 20 °C) |
| refractive index | 1.44 |
| Flash point: | 98 °C |
| storage temp. | Store below +30°C. |
| solubility | 7g/l |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.991.997 |
| Water Solubility | Soluble in water (partly miscible), acetone and heptane. |
| BRN | 104873 |
| InChI | InChI=1S/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2 |
| InChIKey | LFKLPJRVSHJZPL-UHFFFAOYSA-N |
| SMILES | C(C1CO1)CCCC1CO1 |
| CAS DataBase Reference | 2426-07-5(CAS DataBase Reference) |
| EPA Substance Registry System | Oxirane, 2,2'-(1,4-butanediyl)bis- (2426-07-5) |
Safety
| Symbol(GHS) |
  GHS06,GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H311-H341-H350 | |||||||||
| Precautionary statements | P201-P280-P301+P312+P330-P302+P352+P312-P308+P313 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type ABEK (EN14387) respirator filter | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 22-24-68-45 | |||||||||
| Safety Statements | 36/37/39-45-53 | |||||||||
| RIDADR | UN 2810 6.1/PG 3 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | RG9450000 | |||||||||
| Autoignition Temperature | 350°C (DIN 51794) | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2910900090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Acute Tox. 3 Dermal Acute Tox. 4 Oral Carc. 1B Muta. 2 |
|||||||||
| Limited Quantities | 5.0 L (1.3 gallons) (liquid) or 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|