2426-07-5
| Name | 1,2,7,8-DIEPOXYOCTANE |
| CAS | 2426-07-5 |
| EINECS(EC#) | 219-375-9 |
| Molecular Formula | C8H14O2 |
| MDL Number | MFCD00005155 |
| Molecular Weight | 142.2 |
| MOL File | 2426-07-5.mol |
Chemical Properties
| Appearance | clear colorless to slightly yellow liquid |
| Melting point | 7°C |
| Boiling point | 240 °C(lit.) |
| density | 0.997 g/mL at 25 °C(lit.) |
| vapor pressure | <1 hPa ( 20 °C) |
| refractive index | n |
| Fp | 208 °F |
| storage temp. | Store below +30°C. |
| solubility | 7g/l |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.991.997 |
| Water Solubility | Soluble in water (partly miscible), acetone and heptane. |
| BRN | 104873 |
| InChI | InChI=1S/C8H14O2/c1(3-7-5-9-7)2-4-8-6-10-8/h7-8H,1-6H2 |
| InChIKey | LFKLPJRVSHJZPL-UHFFFAOYSA-N |
| SMILES | C(C1CO1)CCCC1CO1 |
| CAS DataBase Reference | 2426-07-5(CAS DataBase Reference) |
| EPA Substance Registry System | Oxirane, 2,2'-(1,4-butanediyl)bis- (2426-07-5) |
Safety Data
| Symbol(GHS) |   GHS06,GHS08 |
| Signal word | Danger |
| Hazard statements | H302-H311-H341-H350 |
| Precautionary statements | P201-P280-P301+P312+P330-P302+P352+P312-P308+P313 |
| Hazard Codes | T |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 2810 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | RG9450000 |
| Autoignition Temperature | 350°C (DIN 51794) |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29109000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 4 Oral Carc. 1B Muta. 2 |