Perfluoroheptanoic acid
- Product NamePerfluoroheptanoic acid
- CAS375-85-9
- CBNumberCB6489085
- MFC7HF13O2
- MW364.06
- EINECS206-798-9
- MDL NumberMFCD00039604
- MOL File375-85-9.mol
Chemical Properties
| Melting point: | 30 °C (lit.) |
| Boiling point: | 175 °C/742 mmHg (lit.) |
| Density | 1.792 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point: | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | PBS (pH 7.2): 2 mg/ml |
| form | Liquid After Melting |
| pka | 0.47±0.10(Predicted) |
| Specific Gravity | 1.792 |
| color | Clear colorless to pale yellow |
| Water Solubility | Insoluble in water. |
| FreezingPoint | 30.0 to 34.0 ℃ |
| BRN | 1808210 |
| Henry's Law Constant | 1.7×100 mol/(m3Pa) at 25℃, Kwan (2001) |
| Stability: | Stable. Incompatible with strong bases. |
| InChI | 1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) |
| InChIKey | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| CAS DataBase Reference | 375-85-9(CAS DataBase Reference) |
| EPA Substance Registry System | Perfluoroheptanoic acid (375-85-9) |
Safety
| Symbol(GHS) |
 GHS08 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H360D-H372 | |||||||||
| Precautionary statements | P202-P260-P264-P270-P280-P308+P313 | |||||||||
| target organs | Liver | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 22-34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2915900090 | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications |
Repr. 1B STOT RE 1 |
|||||||||
| Hazardous Substances Data | 375-85-9(Hazardous Substances Data) | |||||||||
| NFPA 704: |
|