375-85-9
| Name | Perfluoroheptanoic acid |
| CAS | 375-85-9 |
| EINECS(EC#) | 206-798-9 |
| Molecular Formula | C7HF13O2 |
| MDL Number | MFCD00039604 |
| Molecular Weight | 364.06 |
| MOL File | 375-85-9.mol |
Chemical Properties
| Appearance | white solid |
| Melting point | 30 °C (lit.) |
| Boiling point | 175 °C/742 mmHg (lit.) |
| density | 1.792 g/mL at 25 °C(lit.) |
| refractive index | n |
| Fp | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | PBS (pH 7.2): 2 mg/ml |
| form | Liquid After Melting |
| pka | 0.47±0.10(Predicted) |
| color | Clear colorless to pale yellow |
| Specific Gravity | 1.792 |
| Stability: | Stable. Incompatible with strong bases. |
| Water Solubility | Insoluble in water. |
| FreezingPoint | 30.0 to 34.0 ℃ |
| BRN | 1808210 |
| InChI | 1S/C7HF13O2/c8-2(9,1(21)22)3(10,11)4(12,13)5(14,15)6(16,17)7(18,19)20/h(H,21,22) |
| InChIKey | ZWBAMYVPMDSJGQ-UHFFFAOYSA-N |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
Safety Data
| Symbol(GHS) |  GHS08 |
| Signal word | Danger |
| Hazard statements | H360D-H372 |
| Precautionary statements | P202-P260-P264-P270-P280-P308+P313 |
| Hazard Codes | C |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3261 8/PG 2 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| TSCA | T |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 29159000 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Repr. 1B STOT RE 1 |
| Hazardous Substances Data | 375-85-9(Hazardous Substances Data) |