Nonamethyltrisilazane
- Product NameNonamethyltrisilazane
- CAS1586-73-8
- CBNumberCB6401616
- MFC9H27NSi3
- MW233.57
- EINECS216-445-0
- MDL NumberMFCD00047990
- MOL File1586-73-8.mol
Chemical Properties
| Melting point: | 67-69 °C (lit.) |
| Boiling point: | 72 °C/10 mmHg (lit.) |
| Density | 0.863 |
| refractive index | 1.4550 |
| Flash point: | 67°C |
| storage temp. | 2-8°C, sealed storage, away from moisture and light |
| pka | pK1:4.70(+1) (25°C) |
| form | solid |
| Specific Gravity | 0.8635 |
| color | white to colorless waxy |
| Sensitive | Moisture Sensitive |
| Hydrolytic Sensitivity | 7: reacts slowly with moisture/water |
| BRN | 1851880 |
| InChI | InChI=1S/C9H27NSi3/c1-11(2,3)10(12(4,5)6)13(7,8)9/h1-9H3 |
| InChIKey | PEGHITPVRNZWSI-UHFFFAOYSA-N |
| SMILES | [Si](C)(C)(C)N([Si](C)(C)C)[Si](C)(C)C |
| CAS DataBase Reference | 1586-73-8(CAS DataBase Reference) |
| EPA Substance Registry System | Silanamine, 1,1,1-trimethyl-N,N-bis(trimethylsilyl)- (1586-73-8) |
Safety
| Symbol(GHS) |
 GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 |
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3259 8/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | TSCA listed |
| HazardClass | 8 |
| PackingGroup | III |
| HS Code | 2931900090 |
| Storage Class | 8A - Combustible corrosive hazardous materials |
| Hazard Classifications | Skin Corr. 1B |