2-Butyl-1-octanol
- Product Name2-Butyl-1-octanol
- CAS3913-02-8
- CBNumberCB6358949
- MFC12H26O
- MW186.33
- EINECS223-470-0
- MDL NumberMFCD00053508
- MOL File3913-02-8.mol
Chemical Properties
| Melting point: | -80 °C |
| Boiling point: | 104 °C/3 mmHg |
| Density | 0.84 |
| vapor pressure | 8.1Pa at 37.8℃ |
| refractive index | 1.44 |
| Flash point: | 110 °C |
| storage temp. | Store at room temperature |
| form | clear liquid |
| pka | 15.09±0.10(Predicted) |
| color | Colorless to Almost colorless |
| Water Solubility | 1mg/L at 23℃ |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Cosmetics Ingredients Functions | HUMECTANT SOLVENT |
| InChI | InChI=1S/C12H26O/c1-3-5-7-8-10-12(11-13)9-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | XMVBHZBLHNOQON-UHFFFAOYSA-N |
| SMILES | C(O)C(CCCC)CCCCCC |
| LogP | 5.5 at 23℃ |
| EPA Substance Registry System | 2-Butyloctanol (3913-02-8) |
Safety
| Symbol(GHS) |
 GHS09 |
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H410 | |||||||||
| Precautionary statements | P273-P391-P501 | |||||||||
| PPE | Eyeshields, Gloves | |||||||||
| Hazard Codes | N | |||||||||
| Risk Statements | 50-50/53 | |||||||||
| Safety Statements | 57-61 | |||||||||
| RIDADR | UN 3082 9 / PGIII | |||||||||
| WGK Germany | 2 | |||||||||
| RTECS | RH0885000 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2905199090 | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class | 10 - Combustible liquids | |||||||||
| Hazard Classifications |
Aquatic Acute 1 Aquatic Chronic 1 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|