3913-02-8
| Name | 2-BUTYL-1-OCTANOL |
| CAS | 3913-02-8 |
| EINECS(EC#) | 223-470-0 |
| Molecular Formula | C12H26O |
| MDL Number | MFCD00053508 |
| Molecular Weight | 186.33 |
| MOL File | 3913-02-8.mol |
Chemical Properties
| Appearance | liquid |
| Melting point | -80°C(lit.) |
| Boiling point | 145-149 °C(lit.) |
| density | 0.833 g/mL at 25 °C(lit.) |
| vapor pressure | 8.1Pa at 37.8℃ |
| refractive index | 1.4400 to 1.4440 |
| Fp | 113 °C |
| storage temp. | Store at room temperature |
| form | clear liquid |
| pka | 15.09±0.10(Predicted) |
| color | Colorless to Almost colorless |
| Stability: | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Water Solubility | 1mg/L at 23℃ |
| Cosmetics Ingredients Functions | HUMECTANT SOLVENT |
| InChI | InChI=1S/C12H26O/c1-3-5-7-8-10-12(11-13)9-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | XMVBHZBLHNOQON-UHFFFAOYSA-N |
| SMILES | C(O)C(CCCC)CCCCCC |
| LogP | 5.5 at 23℃ |
| EPA Substance Registry System | 2-Butyloctanol (3913-02-8) |
Safety Data
| Symbol(GHS) |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Precautionary statements | P273-P391-P501 |
| Hazard Codes | N |
| Risk Statements | |
| Safety Statements | |
| RIDADR | UN 3082 9 / PGIII |
| WGK Germany | 2 |
| RTECS | RH0885000 |
| TSCA | TSCA listed |
| HS Code | 2905.19.9090 |
| REACH Registrations | Active |
| HazardClass | 9 |
| PackingGroup | III |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 |
| Safety Profile |