α-Ketoglutaric acid disodium salt
- Product Nameα-Ketoglutaric acid disodium salt
- CAS305-72-6
- CBNumberCB6351036
- MFC5H6O5.2Na
- MW192.08
- EINECS206-167-8
- MDL NumberMFCD00043347
- MOL File305-72-6.mol
Chemical Properties
| Density | 1.824 at 20℃ |
| vapor pressure | 0.02Pa at 20-50℃ |
| storage temp. | 2-8°C |
| form | Crystalline Powder or Granules |
| color | White |
| Water Solubility | soluble |
| Sensitive | Hygroscopic |
| BRN | 5658566 |
| Major Application | cleaning products cosmetics food and beverages personal care |
| InChI | InChI=1S/C5H6O5.2Na/c6-3(5(9)10)1-2-4(7)8;;/h1-2H2,(H,7,8)(H,9,10);;/q;2*+1/p-2 |
| InChIKey | HSSWOFWCOAQLHZ-UHFFFAOYSA-L |
| SMILES | C(=O)(C(=O)O[Na])CCC(=O)O[Na] |
| LogP | -1.07 at 23℃ and pH7 |
| Surface tension | 65.3mN/m at 1.02g/L and 20℃ |
| CAS DataBase Reference | 305-72-6(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P233-P260-P261-P264-P271-P280-P302+P352-P304-P304+P340-P305+P351+P338-P312-P321-P332+P313-P337+P313-P340-P362-P403-P403+P233-P405-P501 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | T | |||||||||
| Risk Statements | 23/24/25-36/37/38 | |||||||||
| Safety Statements | 22-24/25-45-36/37/39-26 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | SA0454700 | |||||||||
| HS Code | 29171900 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|