Triethylammonium acetate
- Product NameTriethylammonium acetate
- CAS5204-74-0
- CBNumberCB6249757
- MFC8H19NO2
- MW161.24
- EINECS225-995-0
- MDL NumberMFCD00151725
- MOL File5204-74-0.mol
Chemical Properties
| Melting point: | -18 °C |
| Boiling point: | 164.5 °C (328.1 °F; 437.6 K) |
| Density | 1.01 |
| refractive index | n 20/D 1.357 |
| Flash point: | Not applicable |
| storage temp. | 2-8°C |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.002 |
| PH | 7.0 |
| Stability: | Stable. Incompatible with strong oxidizing agents, bases. |
| InChI | 1S/C6H15N.C2H4O2/c1-4-7(5-2)6-3;1-2(3)4/h4-6H2,1-3H3;1H3,(H,3,4) |
| InChIKey | AVBGNFCMKJOFIN-UHFFFAOYSA-N |
| SMILES | [N+H](CC)(CC)CC.[O-]C(=O)C |
| EPA Substance Registry System | Acetic acid, compd. with N,N-diethylethanamine (1:1) (5204-74-0) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P271-P261 |
| Hazard Codes | C,Xi |
| Risk Statements | 35-36/37/38-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2790 8/PG 3 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 2921199090 |
| Storage Class | 10 - Combustible liquids |