| Melting point: |
181-185 °C (dec.)(lit.) |
| Boiling point: |
892.1±65.0 °C(Predicted) |
| Density |
1.515±0.06 g/cm3(Predicted) |
| bulk density |
50kg/m3 |
| storage temp. |
Store below +30°C. |
| solubility |
NaOH: soluble50mg/mL |
| form |
Powder |
| pka |
1.47, 8.24(at 25℃) |
| color |
white to off-white |
| PH Range |
Colorless (8.2) to red (9.8) |
| Water Solubility |
SLIGHTLY SOLUBLE |
| λmax |
575nm, 377nm |
| BRN |
381994 |
| Stability: |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
Sensors, photoconductors, copying materials, rubber, body fiuid testing, determination of calcium, magnesium, tin, method for measuring urea nitrogen, liposomal construct for diagnostic use, cardiovascular disease, antibacterial agent |
| InChIKey |
IYZPEGVSBUNMBE-UHFFFAOYSA-N |
| SMILES |
Cc1cc(cc(CN(CC(O)=O)CC(O)=O)c1O)C2(OC(=O)c3ccccc23)c4cc(C)c(O)c(CN(CC(O)=O)CC(O)=O)c4 |
| EPA Substance Registry System |
Glycine, N,N'-[(3-oxo-1(3H)-isobenzofuranylidene)bis[(6-hydroxy-5-methyl-3,1-phenylene)methylene]]bis[N-(carboxymethyl)- (2411-89-4) |
