4-Chloro-3-(trifluoromethyl)benzonitrile
- Product Name4-Chloro-3-(trifluoromethyl)benzonitrile
- CAS1735-54-2
- CBNumberCB5776182
- MFC8H3ClF3N
- MW205.56
- MDL NumberMFCD00190117
- MOL File1735-54-2.mol
Chemical Properties
| Melting point: | 66-68°C |
| Boiling point: | 100-105°C 11mm |
| Density | 1.43±0.1 g/cm3(Predicted) |
| Flash point: | 100-105°C/11mm |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2103768 |
| InChI | InChI=1S/C8H3ClF3N/c9-7-2-1-5(4-13)3-6(7)8(10,11)12/h1-3H |
| InChIKey | VBPYHJRQZZCFCW-UHFFFAOYSA-N |
| SMILES | C(#N)C1=CC=C(Cl)C(C(F)(F)F)=C1 |
| CAS DataBase Reference | 1735-54-2(CAS DataBase Reference) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H302-H311-H315-H319-H332 | |||||||||
| Precautionary statements | P280h-P305+P351+P338-P309-P310 | |||||||||
| Hazard Codes | T,Xn | |||||||||
| Risk Statements | 20/21/22-36/37/38-36-22 | |||||||||
| Safety Statements | 26-36/37/39 | |||||||||
| RIDADR | 3439 | |||||||||
| Hazard Note | Toxic | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 2926909090 | |||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|