2-Methyl-1-nitronaphthalene
- Product Name2-Methyl-1-nitronaphthalene
- CAS881-03-8
- CBNumberCB5496590
- MFC11H9NO2
- MW187.19
- EINECS212-917-5
- MDL NumberMFCD00003914
- MOL File881-03-8.mol
Chemical Properties
| Melting point: | 79-82 °C(lit.) |
| Boiling point: | 185-186 °C18 mm Hg(lit.) |
| Density | 1.1963 (rough estimate) |
| refractive index | 1.4900 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | powder to crystal |
| color | Light yellow to Amber to Dark green |
| BRN | 1954310 |
| Henry's Law Constant | 1.5×100 mol/(m3Pa) at 25℃, Parnis et al. (2015) |
| InChI | InChI=1S/C11H9NO2/c1-8-6-7-9-4-2-3-5-10(9)11(8)12(13)14/h2-7H,1H3 |
| InChIKey | IZNWACYOILBFEG-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C=CC=C2)=CC=C1C |
| CAS DataBase Reference | 881-03-8(CAS DataBase Reference) |
| EPA Substance Registry System | 1-Nitro-2-methylnaphthalene (881-03-8) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H332-H302-H312 |
| Precautionary statements | P280-P302+P352-P312-P322-P363-P501-P264-P270-P301+P312-P330-P501-P261-P271-P304+P340-P312 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36/37/39-26 |
| WGK Germany | 3 |
| RTECS | QJ9708200 |
| F | 8 |
| Hazard Note | Irritant |
| TSCA | TSCA listed |
| HS Code | 2904209090 |
| Storage Class | 11 - Combustible Solids |