9-Aminoacridine hydrochloride hydrate
- Product Name9-Aminoacridine hydrochloride hydrate
- CAS52417-22-8
- CBNumberCB5452080
- MFC13H13ClN2O
- MW248.71
- EINECS675-675-3
- MDL NumberMFCD00150071
- MOL File52417-22-8.mol
Chemical Properties
| Melting point: | 300 °C(lit.) |
| storage temp. | Store below +30°C. |
| solubility | 3.3g/l |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| Water Solubility | Soluble in water (3.3 g/L) at 20°C. |
| Sensitive | Hygroscopic |
| λmax | 400 nm 420 nm (2nd) |
| Merck | 14,407 |
| BRN | 3707637 |
| Stability: | Stable. Incompatible with strong oxidizing agents, strong bases, acid anhydrides. |
| InChI | InChI=1S/C13H10N2.ClH.H2O/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13;;/h1-8H,(H2,14,15);1H;1H2 |
| InChIKey | OREJEGKBQBIJSJ-UHFFFAOYSA-N |
| SMILES | NC1=C2C=CC=CC2=NC2C=CC=CC1=2.Cl.O |
| CAS DataBase Reference | 52417-22-8(CAS DataBase Reference) |
| EPA Substance Registry System | 9-Aminoacridine hydrochloride monohydrate (52417-22-8) |
Safety
| Symbol(GHS) |
 GHS06 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H301 | |||||||||
| Precautionary statements | P264-P270-P301+P310-P405-P501 | |||||||||
| PPE | Eyeshields, Gloves, type N95 (US) | |||||||||
| Hazard Codes | T,Xn,F | |||||||||
| Risk Statements | 68-23/24/25-40-20/21/22-15-10-25 | |||||||||
| Safety Statements | 22-24/25-45-43-36/37/39-36-7/8 | |||||||||
| RIDADR | 2811 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | AR6850000 | |||||||||
| TSCA | Yes | |||||||||
| HS Code | 2933 99 80 | |||||||||
| HazardClass | 6.1 | |||||||||
| PackingGroup | III | |||||||||
| Storage Class |
6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
|||||||||
| Hazard Classifications | Acute Tox. 3 Oral | |||||||||
| NFPA 704: |
|