2,5-Dichlorobenzenesulfonyl chloride
- Product Name2,5-Dichlorobenzenesulfonyl chloride
- CAS5402-73-3
- CBNumberCB5428593
- MFC6H3Cl3O2S
- MW245.51
- EINECS226-453-6
- MDL NumberMFCD00007429
- MOL File5402-73-3.mol
Chemical Properties
| Melting point: | 36-37 °C(lit.) |
| Boiling point: | 253°C (estimate) |
| Density | 1.608 (estimate) |
| Flash point: | >230 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform, DMSO |
| form | solid |
| color | Off-White to Pale Beige |
| Sensitive | Moisture Sensitive |
| BRN | 2369410 |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-2-5(8)6(3-4)12(9,10)11/h1-3H |
| InChIKey | BXCOSWRSIISQSL-UHFFFAOYSA-N |
| SMILES | Clc1ccc(Cl)c(c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 5402-73-3(CAS DataBase Reference) |
| EPA Substance Registry System | Benzenesulfonyl chloride, 2,5-dichloro- (5402-73-3) |
Safety
| Symbol(GHS) |
  GHS05,GHS07 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335 | |||||||||
| Precautionary statements | P260-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34-36/37 | |||||||||
| Safety Statements | 26-27-28-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | TSCA listed | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2904990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications |
Eye Dam. 1 Skin Corr. 1B STOT SE 3 |
|||||||||
| Limited Quantities | 5.0 kg (11 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (1Kg or 1L) | |||||||||
| NFPA 704: |
|