2,4-Dichlorobenzenesulfonyl chloride
- Product Name2,4-Dichlorobenzenesulfonyl chloride
- CAS16271-33-3
- CBNumberCB8200817
- MFC6H3Cl3O2S
- MW245.51
- EINECS628-025-8
- MDL NumberMFCD00052712
- MOL File16271-33-3.mol
Chemical Properties
| Melting point: | 55-58 °C (lit.) |
| Boiling point: | 114-115°C/0.1mm |
| Density | 1.636±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Chloroform (Sparingly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White to light beige |
| Sensitive | Moisture Sensitive |
| BRN | 2806192 |
| Stability: | Moisture Sensitive |
| InChI | 1S/C6H3Cl3O2S/c7-4-1-2-6(5(8)3-4)12(9,10)11/h1-3H |
| InChIKey | FDTPBIKNYWQLAE-UHFFFAOYSA-N |
| SMILES | Clc1ccc(c(Cl)c1)S(Cl)(=O)=O |
| CAS DataBase Reference | 16271-33-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzenesulfonyl chloride, 2,4-dichloro-(16271-33-3) |
Safety
| Symbol(GHS) |
 GHS05 |
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314 | |||||||||
| Precautionary statements | P260-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338-P363 | |||||||||
| PPE | Eyeshields, Faceshields, Gloves, type P3 (EN 143) respirator cartridges | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 34 | |||||||||
| Safety Statements | 26-36/37/39-45 | |||||||||
| RIDADR | UN 3261 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | DB8927500 | |||||||||
| Hazard Note | Corrosive/Moisture Sensitive | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 2904990090 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B | |||||||||
| Limited Quantities | 1 Kg (2.2 lbs) (solid) | |||||||||
| Excepted Quantities | Max Inner Pack (30g or 30ml) and Max Outer Pack (500g or 500ml) | |||||||||
| NFPA 704: |
|