4,5-Diaminopyrimidine
- Product Name4,5-Diaminopyrimidine
- CAS13754-19-3
- CBNumberCB5376166
- MFC4H6N4
- MW110.12
- EINECS237-339-0
- MDL NumberMFCD00006113
- MOL File13754-19-3.mol
Chemical Properties
| Melting point: | 204 to 206 °C (399 to 403 °F; 477 to 479 K) |
| Boiling point: | 229 °C (444 °F; 502 K) (32 mmHg) |
| Density | 1.2105 (rough estimate) |
| refractive index | 1.7380 (estimate) |
| Flash point: | Not applicable |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| pka | 6.06±0.10(Predicted) |
| form | powder to crystal |
| color | White to Gray to Brown |
| BRN | 112646 |
| InChI | InChI=1S/C4H6N4/c5-3-1-7-2-8-4(3)6/h1-2H,5H2,(H2,6,7,8) |
| InChIKey | PPAULTVPKLVLII-UHFFFAOYSA-N |
| SMILES | C1=NC=C(N)C(N)=N1 |
| CAS DataBase Reference | 13754-19-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 4,5-Pyrimidinediamine(13754-19-3) |
Safety
| Symbol(GHS) |
|
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313 |
| PPE | Eyeshields, Gloves, type N95 (US) |
| WGK Germany | 3 |
| F | 10 |
| HS Code | 2933599090 |
| Storage Class | 11 - Combustible Solids |