5-Nitroso-2,4,6-triaminopyrimidine
- Product Name5-Nitroso-2,4,6-triaminopyrimidine
- CAS1006-23-1
- CBNumberCB2269407
- MFC4H6N6O
- MW154.13
- EINECS213-742-7
- MDL NumberMFCD00006096
- MOL File1006-23-1.mol
Chemical Properties
| Melting point: | 300 °C |
| Boiling point: | 277.47°C (rough estimate) |
| Density | 1.4788 (rough estimate) |
| refractive index | 1.7290 (estimate) |
| storage temp. | -20°C Freezer |
| solubility | DMF (Slightly, Heated), DMSO (Slightly, Heated) |
| pka | 4.07±0.10(Predicted) |
| color | Light Pink to Pink |
| Stability: | Stable. Incompatible with strong oxidizing agents. |
| Major Application | pharmaceutical |
| InChI | InChI=1S/C4H6N6O/c5-2-1(10-11)3(6)9-4(7)8-2/h(H6,5,6,7,8,9) |
| InChIKey | XLQQJSWJHHKLOK-UHFFFAOYSA-N |
| SMILES | C1(N)=NC(N)=C(N=O)C(N)=N1 |
| CAS DataBase Reference | 1006-23-1(CAS DataBase Reference) |
| EPA Substance Registry System | 2,4,6-Pyrimidinetriamine, 5-nitroso- (1006-23-1) |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H319-H335 | |||||||||
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 | |||||||||
| target organs | Respiratory system | |||||||||
| Hazard Codes | Xn,Xi | |||||||||
| Risk Statements | 36/37/38-20/21/22 | |||||||||
| Safety Statements | 24/25-36-26 | |||||||||
| WGK Germany | 3 | |||||||||
| TSCA | TSCA listed | |||||||||
| HS Code | 2933599090 | |||||||||
| Storage Class | 11 - Combustible Solids | |||||||||
| Hazard Classifications |
Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
|||||||||
| REACH Registrations | Active | |||||||||
| NFPA 704: |
|